Skip to main content

Three Divisors

LeetCode 2083 | Difficulty: Easy​

Easy

Problem Description​

Given an integer n, return true* if n has exactly three positive divisors. Otherwise, return *false.

An integer m is a divisor of n if there exists an integer k such that n = k * m.

Example 1:

Input: n = 2
Output: false
Explantion: 2 has only two divisors: 1 and 2.

Example 2:

Input: n = 4
Output: true
Explantion: 4 has three divisors: 1, 2, and 4.

Constraints:

  • 1 <= n <= 10^4

Topics: Math, Enumeration, Number Theory


Approach​

Mathematical​

Look for mathematical patterns or formulas. Consider: modular arithmetic, GCD/LCM, prime factorization, combinatorics, or geometric properties.

When to use

Problems with clear mathematical structure, counting, number properties.


Solutions​

Solution 1: C# (Best: 44 ms)​

MetricValue
Runtime44 ms
Memory15.2 MB
Date2021-08-23
Solution
public class Solution {
public bool IsThree(int n) {
if(n<4) return false;
int count = 1;
for (int i = 2; i <= n/2; i++)
{
if(n%i == 0)
{
count++;
if(count>3) return false;
}
}
count++;
return count == 3;
}
}

Complexity Analysis​

ApproachTimeSpace
SolutionO(n)O(n)O(1)toO(n)O(1) to O(n)

Interview Tips​

Key Points
  • Start by clarifying edge cases: empty input, single element, all duplicates.
  • LeetCode provides 2 hint(s) for this problem β€” try solving without them first.
πŸ’‘ Hints

Hint 1: You can count the number of divisors and just check that they are 3

Hint 2: Beware of the case of n equal 1 as some solutions might fail in it