Skip to main content

Find N Unique Integers Sum up to Zero

LeetCode 1426 | Difficulty: Easy​

Easy

Problem Description​

Given an integer n, return any array containing n unique integers such that they add up to 0.

Example 1:

Input: n = 5
Output: [-7,-1,1,3,4]
Explanation: These arrays also are accepted [-5,-1,1,2,3] , [-3,-1,2,-2,4].

Example 2:

Input: n = 3
Output: [-1,0,1]

Example 3:

Input: n = 1
Output: [0]

Constraints:

  • 1 <= n <= 1000

Topics: Array, Math


Approach​

Mathematical​

Look for mathematical patterns or formulas. Consider: modular arithmetic, GCD/LCM, prime factorization, combinatorics, or geometric properties.

When to use

Problems with clear mathematical structure, counting, number properties.


Solutions​

Solution 1: C# (Best: 123 ms)​

MetricValue
Runtime123 ms
Memory32.7 MB
Date2021-12-17
Solution
public class Solution {
public int[] SumZero(int n) {
int[] result = new int[n];
int sum = 0;

for(int i=0;i<n-1;i++)
{
result[i] = i+1;
sum += result[i];
}
result[n-1] = -sum;

return result;
}
}

Complexity Analysis​

ApproachTimeSpace
SolutionO(n)O(n)O(1)toO(n)O(1) to O(n)

Interview Tips​

Key Points
  • Start by clarifying edge cases: empty input, single element, all duplicates.
  • LeetCode provides 2 hint(s) for this problem β€” try solving without them first.
πŸ’‘ Hints

Hint 1: Return an array where the values are symmetric. (+x , -x).

Hint 2: If n is odd, append value 0 in your returned array.