Skip to main content

Decompress Run-Length Encoded List

LeetCode 1241 | Difficulty: Easy​

Easy

Problem Description​

We are given a list nums of integers representing a list compressed with run-length encoding.

Consider each adjacent pair of elements [freq, val] = [nums[2*i], nums[2*i+1]] (with i >= 0). For each such pair, there are freq elements with value val concatenated in a sublist. Concatenate all the sublists from left to right to generate the decompressed list.

Return the decompressed list.

Example 1:

Input: nums = [1,2,3,4]
Output: [2,4,4,4]
Explanation: The first pair [1,2] means we have freq = 1 and val = 2 so we generate the array [2].
The second pair [3,4] means we have freq = 3 and val = 4 so we generate [4,4,4].
At the end the concatenation [2] + [4,4,4] is [2,4,4,4].

Example 2:

Input: nums = [1,1,2,3]
Output: [1,3,3]

Constraints:

  • 2 1

Topics: Array


Approach​

Direct Approach​

This problem can typically be solved with straightforward iteration or simple data structure usage. Focus on correctness first, then optimize.

When to use

Basic problems that test fundamental programming skills.


Solutions​

Solution 1: C# (Best: 136 ms)​

MetricValue
Runtime136 ms
Memory43 MB
Date2022-01-14
Solution
public class Solution {
public int[] DecompressRLElist(int[] nums) {
int n = nums.Length;
int total = 0;
for (int i = 0; i < n; i=i+2)
{
total += nums[i];
}
int[] result = new int[total];
int index = 0;
for (int i = 0; i < n; i=i+2)
{
int freq = nums[i];
int val = nums[i+1];
for (int j = 0; j < freq; j++)
{
result[index++] = val;
}
}
return result;
}
}

Complexity Analysis​

ApproachTimeSpace
SolutionO(n)O(n)O(1)toO(n)O(1) to O(n)

Interview Tips​

Key Points
  • Start by clarifying edge cases: empty input, single element, all duplicates.
  • LeetCode provides 1 hint(s) for this problem β€” try solving without them first.
πŸ’‘ Hints

Hint 1: Decompress the given array by repeating nums[2i+1] a number of times equal to nums[2i].