Skip to main content

Not Boring Movies

LeetCode 620 | Difficulty: Easy​

Easy

Problem Description​

Table: Cinema

+----------------+----------+
| Column Name | Type |
+----------------+----------+
| id | int |
| movie | varchar |
| description | varchar |
| rating | float |
+----------------+----------+
id is the primary key (column with unique values) for this table.
Each row contains information about the name of a movie, its genre, and its rating.
rating is a 2 decimal places float in the range [0, 10]

Write a solution to report the movies with an odd-numbered ID and a description that is not "boring".

Return the result table ordered by rating in descending order.

The result format is in the following example.

Example 1:

Input:
Cinema table:
+----+------------+-------------+--------+
| id | movie | description | rating |
+----+------------+-------------+--------+
| 1 | War | great 3D | 8.9 |
| 2 | Science | fiction | 8.5 |
| 3 | irish | boring | 6.2 |
| 4 | Ice song | Fantacy | 8.6 |
| 5 | House card | Interesting | 9.1 |
+----+------------+-------------+--------+
Output:
+----+------------+-------------+--------+
| id | movie | description | rating |
+----+------------+-------------+--------+
| 5 | House card | Interesting | 9.1 |
| 1 | War | great 3D | 8.9 |
+----+------------+-------------+--------+
Explanation:
We have three movies with odd-numbered IDs: 1, 3, and 5. The movie with ID = 3 is boring so we do not include it in the answer.

Topics: Database


Approach​

Direct Approach​

This problem can typically be solved with straightforward iteration or simple data structure usage. Focus on correctness first, then optimize.

When to use

Basic problems that test fundamental programming skills.


Solutions​

Solution 1: MySQL (Best: 131 ms)​

MetricValue
Runtime131 ms
MemoryN/A
Date2018-04-12
Solution
# Write your MySQL query statement below
select * from cinema
where (id%2) <> 0 and description <> 'boring'
order by rating desc

Complexity Analysis​

ApproachTimeSpace
SolutionO(n)O(n)O(1)toO(n)O(1) to O(n)

Interview Tips​

Key Points
  • Start by clarifying edge cases: empty input, single element, all duplicates.