Skip to main content

Combine Two Tables

LeetCode 175 | Difficulty: Easy​

Easy

Problem Description​

Table: Person

+-------------+---------+
| Column Name | Type |
+-------------+---------+
| personId | int |
| lastName | varchar |
| firstName | varchar |
+-------------+---------+
personId is the primary key (column with unique values) for this table.
This table contains information about the ID of some persons and their first and last names.

Table: Address

+-------------+---------+
| Column Name | Type |
+-------------+---------+
| addressId | int |
| personId | int |
| city | varchar |
| state | varchar |
+-------------+---------+
addressId is the primary key (column with unique values) for this table.
Each row of this table contains information about the city and state of one person with ID = PersonId.

Write a solution to report the first name, last name, city, and state of each person in the Person table. If the address of a personId is not present in the Address table, report null instead.

Return the result table in any order.

The result format is in the following example.

Example 1:

Input:
Person table:
+----------+----------+-----------+
| personId | lastName | firstName |
+----------+----------+-----------+
| 1 | Wang | Allen |
| 2 | Alice | Bob |
+----------+----------+-----------+
Address table:
+-----------+----------+---------------+------------+
| addressId | personId | city | state |
+-----------+----------+---------------+------------+
| 1 | 2 | New York City | New York |
| 2 | 3 | Leetcode | California |
+-----------+----------+---------------+------------+
Output:
+-----------+----------+---------------+----------+
| firstName | lastName | city | state |
+-----------+----------+---------------+----------+
| Allen | Wang | Null | Null |
| Bob | Alice | New York City | New York |
+-----------+----------+---------------+----------+
Explanation:
There is no address in the address table for the personId = 1 so we return null in their city and state.
addressId = 1 contains information about the address of personId = 2.

Topics: Database


Approach​

Direct Approach​

This problem can typically be solved with straightforward iteration or simple data structure usage. Focus on correctness first, then optimize.

When to use

Basic problems that test fundamental programming skills.


Solutions​

Solution 1: MySQL (Best: 214 ms)​

MetricValue
Runtime214 ms
MemoryN/A
Date2018-04-13
Solution
# Write your MySQL query statement below
SELECT FirstName, LastName, City, State
FROM
Person P
LEFT JOIN Address A ON A.PersonId = P.PersonId

Complexity Analysis​

ApproachTimeSpace
SolutionO(n)O(n)O(1)toO(n)O(1) to O(n)

Interview Tips​

Key Points
  • Start by clarifying edge cases: empty input, single element, all duplicates.