Skip to main content

Multiply Strings

LeetCode 43 | Difficulty: Medium​

Medium

Problem Description​

Given two non-negative integers num1 and num2 represented as strings, return the product of num1 and num2, also represented as a string.

Note: You must not use any built-in BigInteger library or convert the inputs to integer directly.

Example 1:

Input: num1 = "2", num2 = "3"
Output: "6"

Example 2:

Input: num1 = "123", num2 = "456"
Output: "56088"

Constraints:

  • 1 <= num1.length, num2.length <= 200

  • num1 and num2 consist of digits only.

  • Both num1 and num2 do not contain any leading zero, except the number 0 itself.

Topics: Math, String, Simulation


Approach​

Mathematical​

Look for mathematical patterns or formulas. Consider: modular arithmetic, GCD/LCM, prime factorization, combinatorics, or geometric properties.

When to use

Problems with clear mathematical structure, counting, number properties.

String Processing​

Consider character frequency counts, two-pointer approaches, or building strings efficiently. For pattern matching, think about KMP or rolling hash. For palindromes, expand from center or use DP.

When to use

Anagram detection, palindrome checking, string transformation, pattern matching.


Solutions​

Solution 1: C# (Best: 159 ms)​

MetricValue
Runtime159 ms
MemoryN/A
Date2017-10-29
Solution
public class Solution {
public string Multiply(string num1, string num2) {
int[] sum = new int[num1.Length + num2.Length];

for (int i = num1.Length-1; i>=0; i--)
{
int carry = 0;
for (int j = num2.Length-1; j>=0; j--)
{
int tmp = (sum[i + j + 1]) + (num1[i] - '0') * (num2[j] - '0') + carry;
sum[i + j + 1] = tmp%10;
carry = tmp / 10;
}
sum[i] += carry;
}
var result = string.Join("",sum).TrimStart('0');
return string.IsNullOrEmpty(result) ? "0" : result;
}
}

Complexity Analysis​

ApproachTimeSpace
SolutionO(n)O(n)O(1)toO(n)O(1) to O(n)

Interview Tips​

Key Points
  • Discuss the brute force approach first, then optimize. Explain your thought process.